Nome del prodotto |
Tetraphenylphthalic anhydride |
Sinonimi |
4,5,6,7-tetraphenyl-2-benzofuran-1,3-dione |
Formula molecolare |
C32H20O3 |
Peso Molecolare |
452.4994 |
InChI |
InChI=1/C32H20O3/c33-31-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30(29)32(34)35-31)24-19-11-4-12-20-24/h1-20H |
Numero CAS |
4741-53-1 |
EINECS |
225-253-6 |
Struttura molecolare |
|
Densità |
1.244g/cm3 |
Punto di ebollizione |
596°C at 760 mmHg |
Indice di rifrazione |
1.658 |
Punto d'infiammabilità |
290.4°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|