Nama produk |
4-Dimethylaminobenzoylchloride |
Sinonim |
4-Dimethylaminobenzoyl chloride; 4-(ethylamino)benzoyl chloride |
MF |
C9H10ClNO |
Berat Molekul |
183.6348 |
InChI |
InChI=1/C9H10ClNO/c1-11(2)8-5-3-7(4-6-8)9(10)12/h3-6H,1-2H3 |
CAS NO |
4755-50-4 |
Struktur Molekul |
|
Kepadatan |
1.193g/cm3 |
Titik didih |
279°C at 760 mmHg |
Indeks bias |
1.574 |
Titik nyala |
122.5°C |
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|