Produkt-Name |
7-methylindole 3-carboxaldehyde |
Synonyme |
7-Methylindole-3-carboxaldehyde; 3-Formyl-7-methylindole; 7-methyl-1H-indole-3-carbaldehyde |
Molekulare Formel |
C10H9NO |
Molecular Weight |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-7-3-2-4-9-8(6-12)5-11-10(7)9/h2-6,11H,1H3 |
CAS Registry Number |
4771-50-0 |
Molecular Structure |
|
Dichte |
1.226g/cm3 |
Siedepunkt |
341°C at 760 mmHg |
Brechungsindex |
1.698 |
Flammpunkt |
168°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|