product Name |
Isopropyl Phenylacetate |
Synonyms |
1-Methylethyl benzeneacetate; Acetic acid, phenyl-, isopropyl ester; Benzeneacetic acid, 1-methylethyl ester; FEMA No. 2956; Isopropyl alpha-toluate; propan-2-yl phenylacetate |
Molecular Formula |
C11H14O2 |
Molecular Weight |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-9(2)13-11(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
CAS Registry Number |
4861-85-2 |
EINECS |
225-468-5 |
Molecular Structure |
|
Density |
1.014g/cm3 |
Boiling point |
237.7°C at 760 mmHg |
Refractive index |
1.497 |
Flash point |
97.5°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|