상품명칭 |
1-(2-Morpholinoethyl)-piperazin |
별명 |
1-(2-Morpholinoethyl)-piperazine; 1-[2-(Morpholin-4-yl)ethyl]piperazine; 4-(2-piperazin-1-ylethyl)morpholine; 1-(2-morpholin-4-ium-4-ylethyl)piperazinediium |
분자식 |
C10H24N3O |
분자량 |
202.3154 |
InChI |
InChI=1/C10H21N3O/c1-3-12(4-2-11-1)5-6-13-7-9-14-10-8-13/h11H,1-10H2/p+3 |
cas번호 |
4892-89-1 |
분자 구조 |
|
비등점 |
292.4°C at 760 mmHg |
인화점 |
130.6°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|