Nama produk |
3,3',4,4'-Tetramethylbiphenyl |
Sinonim |
3,3',4,4'-Tetramethyl-1,1'-biphenyl; 3,3',4,4'-Tetramethyldiphenyl; 3,4,3',4'-Tetramethylbiphenyl; 4-05-00-01956 (Beilstein Handbook Reference); BRN 1935370; 1,1'-Biphenyl, 3,3',4,4'-tetramethyl- (9CI); Biphenyl, 3,3',4,4'-tetramethyl- |
MF |
C16H18 |
Berat Molekul |
210.3141 |
InChI |
InChI=1/C16H18/c1-11-5-7-15(9-13(11)3)16-8-6-12(2)14(4)10-16/h5-10H,1-4H3 |
CAS NO |
4920-95-0 |
Struktur Molekul |
|
Kepadatan |
0.956g/cm3 |
Titik didih |
317.5°C at 760 mmHg |
Indeks bias |
1.551 |
Titik nyala |
151.6°C |
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|