상품명칭 |
5-Bromobenzo[b]thiophene |
별명 |
5-Bromothianaphthene; 5-bromo-1-benzothiophene; 5-Bromobenzo[b]thioophene; 5-Bromobenzothiophene; ; BUTTPARK 98\04-80; Benzo[c]thiophene, 5-bromo- |
분자식 |
C8H5BrS |
분자량 |
213.0943 |
InChI |
InChI=1/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
cas번호 |
4923-87-9;133150-64-8 |
분자 구조 |
|
밀도 |
1.649g/cm3 |
녹는 점 |
46℃ |
비등점 |
284.7°C at 760 mmHg |
굴절 지수 |
1.704 |
인화점 |
126°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|