نام محصول |
cis-Decahydronaphthalene |
مترادف |
cis-bicyclo(4.4.0)decane; cis-decaline; Decahydronaphthalene; Deca hydro naphthalene; Decalin |
میدان مغناطیسی |
C10H18 |
وزن مولکولی |
138.2499 |
InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
شماره سیایاس |
493-01-6;91-17-8 |
تعداد کمیسیون اروپایی |
202-046-9 |
ساختار مولکولی |
|
تراکم |
0.873g/cm3 |
نقطه ذوب |
-31℃ |
نقطه غلیان |
190.879°C at 760 mmHg |
ضریب شکست |
1.47 |
نقطه اشتعال |
57.222°C |
حلالیت آب |
6 mg/L at 20℃ |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|