Ονομασία του προϊόντος |
4-Pentylbenzoyl chloride |
Συνώνυμα |
4-n-Amylbenzoyl chloride; Benzoyl chloride, 4-pentyl- |
MF |
C12H15ClO |
Μοριακό βάρος |
210.6999 |
InChI |
InChI=1/C12H15ClO/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9H,2-5H2,1H3 |
CAS ΟΧΙ |
49763-65-7 |
EINECS |
256-478-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.063g/cm3 |
Σημείο βρασμού |
288.4°C at 760 mmHg |
Δείκτης διάθλασης |
1.516 |
Σημείο ανάφλεξης |
130.3°C |
Κινδύνου Κώδικες |
R34:Causes burns.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|