نام محصول |
4-Methoxymetanilyl fluoride |
مترادف |
3-amino-4-methoxyphenylsulphonyl fluoride; Aminomethoxybenzenesulfonylfluoride; 3-Amino-4-methoxAV21428; 3-amino-4-methoxybenzenesulfonyl fluoride; 3-fluorobenzohydrazide |
میدان مغناطیسی |
C7H7FN2O |
وزن مولکولی |
154.1417 |
InChI |
InChI=1/C7H7FN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
شماره سیایاس |
498-74-8 |
تعداد کمیسیون اروپایی |
207-870-2 |
ساختار مولکولی |
|
تراکم |
1.272g/cm3 |
نقطه ذوب |
60-65℃ |
نقطه غلیان |
312.6°C at 760 mmHg |
ضریب شکست |
1.552 |
نقطه اشتعال |
142.8°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|