termék neve |
3-n-Pentadecylphenol |
Szinonimák |
Pentadecylphenol; 3-pentadecylphenol; 3-Pentadecyl phenol |
MF |
C21H36O |
Molekulatömeg |
304.5099 |
InChI |
InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
CAS-szám |
501-24-6 |
EINECS |
207-921-9 |
Molekuláris szerkezete |
|
Sűrűség |
0.908g/cm3 |
Olvadáspont |
47-53℃ |
Forráspont |
402°C at 760 mmHg |
Törésmutató |
1.495 |
Gyulladáspont |
246.3°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|