اسم المنتج |
5-Bromo-2-fluoropyridine-3-boronic acid |
الاسم المستعار |
5-Bromo-2-fluoro-3-pyridylboronic acid; (5-bromo-2-fluoropyridin-3-yl)boronic acid; 2-Fluoro-5-Bromopyridine-3-Boronic Acid |
الصيغة الجزيئية |
C5H4BBrFNO2 |
الوزن الجزيئي الغرامي |
219.8042 |
InChI |
InChI=1/C5H4BBrFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H |
إستراتيجية المساعدة القطرية |
501435-91-2 |
بنية جزيئية |
|
كثافة |
1.86g/cm3 |
نقطة الغليان |
357.1°C at 760 mmHg |
معامل الإنكسار |
1.574 |
نقطة الوميض |
169.7°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|