상품명칭 |
4-Ketopimelic acid |
별명 |
4-Oxopimelic acid; 4-oxoheptanedioic acid; 4-oxoheptanedioate |
분자식 |
C7H8O5 |
분자량 |
172.1365 |
InChI |
InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
cas번호 |
502-50-1 |
EC번호 |
207-941-8 |
분자 구조 |
|
녹는 점 |
142-144℃ |
비등점 |
420.4°C at 760 mmHg |
인화점 |
222.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|