Produkt-Name |
(2,4-dimethyl-1,3-thiazol-5-yl)methanol |
Synonyme |
(2,4-dimethylthiazol-5-yl)methanol;
|
Molekulare Formel |
C6H9NOS |
Molecular Weight |
143.2068 |
InChI |
InChI=1/C6H9NOS/c1-4-6(3-8)9-5(2)7-4/h8H,3H2,1-2H3 |
CAS Registry Number |
50382-32-6 |
Molecular Structure |
|
Dichte |
1.208g/cm3 |
Schmelzpunkt |
46℃ |
Siedepunkt |
261.965°C at 760 mmHg |
Brechungsindex |
1.569 |
Flammpunkt |
112.233°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|