product Name |
5-chloro-3-methyl-1-benzothiophene-2-carboxylic acid |
Molecular Formula |
C10H7ClO2S |
Molecular Weight |
226.6794 |
InChI |
InChI=1/C10H7ClO2S/c1-5-7-4-6(11)2-3-8(7)14-9(5)10(12)13/h2-4H,1H3,(H,12,13) |
CAS Registry Number |
50451-84-8 |
Molecular Structure |
|
Density |
1.474g/cm3 |
Melting point |
298℃ |
Boiling point |
411.7°C at 760 mmHg |
Refractive index |
1.695 |
Flash point |
202.8°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|