상품명칭 |
2,4,6-Trifluorophenyl isocyanate |
별명 |
1,3,5-trifluoro-2-isocyanatobenzene |
분자식 |
C7H2F3NO |
분자량 |
173.0921 |
InChI |
InChI=1/C7H2F3NO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
cas번호 |
50528-80-8 |
분자 구조 |
|
밀도 |
1.35g/cm3 |
비등점 |
166.4°C at 760 mmHg |
굴절 지수 |
1.473 |
인화점 |
52.2°C |
리스크 규칙 |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|