Nome del prodotto |
4-dimethylaminopiperidine |
Sinonimi |
4-(Dimethylamino)piperidine; N,N-dimethylpiperidin-4-amine |
Formula molecolare |
C7H16N2 |
Peso Molecolare |
128.2153 |
InChI |
InChI=1/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3 |
Numero CAS |
50533-97-6 |
EINECS |
256-617-2 |
Struttura molecolare |
|
Densità |
0.91g/cm3 |
Punto di ebollizione |
179.7°C at 760 mmHg |
Indice di rifrazione |
1.479 |
Punto d'infiammabilità |
63.3°C |
Codici di Rischio |
R10:Flammable.;
R34:Causes burns.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|