product Name |
5-acetamino-2-aminobenzoic acid |
Synonyms |
2-Amino-5-Acetamino Benzoic Acid; 5-acetamide-2-amino-benzoic acid; 5-(acetylamino)-2-aminobenzoic acid; 5-Acetylamino anthranilic acid; 5-Acetamidoanthranilic acid |
Molecular Formula |
C9H10N2O3 |
Molecular Weight |
194.1873 |
InChI |
InChI=1/C9H10N2O3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,10H2,1H3,(H,11,12)(H,13,14) |
CAS Registry Number |
50670-83-2 |
EINECS |
256-702-4 |
Molecular Structure |
|
Density |
1.414g/cm3 |
Boiling point |
365.8°C at 760 mmHg |
Refractive index |
1.676 |
Flash point |
175.1°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|