نام محصول |
Triethylenemelamine |
مترادف |
Tretamine; 2,4,6-tri(aziridin-1-yl)-1,3,5-triazine; 2,4,6-Tris(1-aziridinyl)-s-triazine; TEM; 2,4,6-tris(aziridin-1-yl)-1,3,5-triazine |
میدان مغناطیسی |
C9H12N6 |
وزن مولکولی |
204.2318 |
InChI |
InChI=1/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
شماره سیایاس |
51-18-3 |
تعداد کمیسیون اروپایی |
200-083-5 |
ساختار مولکولی |
|
تراکم |
1.617g/cm3 |
نقطه ذوب |
160℃ |
نقطه غلیان |
430.2°C at 760 mmHg |
ضریب شکست |
1.789 |
نقطه اشتعال |
214°C |
خطر نمادها |
T+:Very toxic;
|
کدهای خطر |
R28:Very toxic if swallowed.;
R40:Possible risks of irreversible effects.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|