상품명칭 |
Bis(diphenylphosphino)acetylene |
별명 |
Ethynylenebis(diphenylphosphine); ethyne-1,2-diylbis(diphenylphosphane) |
분자식 |
C26H20P2 |
분자량 |
394.3845 |
InChI |
InChI=1/C26H20P2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H |
cas번호 |
5112-95-8 |
EC번호 |
225-842-8 |
분자 구조 |
|
녹는 점 |
84-88℃ |
비등점 |
529.6°C at 760 mmHg |
인화점 |
291.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|