Nazwa produktu: |
4-Ethylphenylacetonitrile |
Synonimy |
4-Ethylbenzyl cyanide |
MF |
C10H11N |
Masie cząsteczkowej |
145.201 |
InChI |
InChI=1/C10H11N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7H2,1H3 |
Nr CAS |
51632-28-1 |
Struktury molekularnej |
|
Gęstość |
0.978g/cm3 |
Temperatura wrzenia |
252.8°C at 760 mmHg |
Współczynnik załamania |
1.521 |
Temperatura zapłonu |
116.1°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|