اسم المنتج |
Tris-(2-carboxyethyl)-phosphine hydrochloride |
الاسم المستعار |
Tris(2-carboxyethyl)phosphine hydrochloride; 3,3',3''-phosphanetriyltripropanoic acid hydrochloride; 3,3',3''-phosphanetriyltripropanoate |
الصيغة الجزيئية |
C9H12O6P |
الوزن الجزيئي الغرامي |
247.1634 |
InChI |
InChI=1/C9H15O6P/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15/h1-6H2,(H,10,11)(H,12,13)(H,14,15)/p-3 |
إستراتيجية المساعدة القطرية |
51805-45-9 |
بنية جزيئية |
|
نقطة الغليان |
519.4°C at 760 mmHg |
نقطة الوميض |
267.9°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|