product Name |
3-Bromobenzaldehyde oxime |
Synonyms |
3-Bromobenzaldoxime |
Molecular Formula |
C7H6BrNO |
Molecular Weight |
200.0326 |
InChI |
InChI=1/C7H6BrNO/c8-7-3-1-2-6(4-7)5-9-10/h1-5,10H/b9-5- |
CAS Registry Number |
51873-95-1 |
Molecular Structure |
|
Density |
1.52g/cm3 |
Melting point |
73-76℃ |
Boiling point |
266.7°C at 760 mmHg |
Refractive index |
1.581 |
Flash point |
115.1°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|