Nome do produto |
5-ETHYL-2-PYRIDYLETHANOL |
Sinônimos |
5-Ethyl-2-(2-hydroxyethyl)pyridine; 2-(5-ethyl-2-pyridinyl)-1-ethanol; 2-(5-Ethyl-2-pyridyl)ethanol; 2-(5-ethyl pyridin-2-yl)ethanol; 2-(5-Ethyl-2-pyridinyl)ethanol; 5-Ethyl-2-pyridineethanol |
Fórmula molecular |
C9H13NO |
Peso Molecular |
151.21 |
InChI |
InChI=1/C9H13NO/c1-2-8-3-4-9(5-6-11)10-7-8/h3-4,7,11H,2,5-6H2,1H3 |
CAS Registry Number |
5223-06-3 |
EINECS |
226-024-3 |
Estrutura Molecular |
|
Ponto de ebulição |
127℃ (5 mmHg) |
Códigos de risco |
R21:Harmful in contact with skin.;
R36:Irritating to eyes.;
|
Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|