상품명칭 |
Gluconic acid |
별명 |
D-Gluconic acid solution; Gluconicacidaqsoln; D-Gluconic acid; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (non-preferred name); Gluconic Acid Solution |
분자식 |
C6H11O7 |
분자량 |
195.1479 |
InChI |
InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5-/m1/s1 |
cas번호 |
526-95-4 |
EC번호 |
208-401-4 |
분자 구조 |
|
녹는 점 |
15℃ |
비등점 |
673.6°C at 760 mmHg |
인화점 |
375.1°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|