상품명칭 |
2-Methyl-6-isopropylaniline |
별명 |
2-Methyl-6-(1-methylethyl)benzenamine; 2-Isopropyl-6-methylaniline; 6-isopropyl-o-toluidine; 2-methyl-6-(propan-2-yl)aniline |
분자식 |
C10H15N |
분자량 |
149.2328 |
InChI |
InChI=1/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3 |
cas번호 |
5266-85-3 |
EC번호 |
226-083-5 |
분자 구조 |
|
밀도 |
0.944g/cm3 |
비등점 |
236.2°C at 760 mmHg |
굴절 지수 |
1.538 |
인화점 |
97.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|