Nazwa produktu: |
2,5-Dimethoxybenzonitrile |
Synonimy |
3-{3-methoxy-4-[(3-methylbenzyl)oxy]phenyl}-2-(6-methyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
MF |
C26H23N3O2 |
Masie cząsteczkowej |
409.4797 |
InChI |
InChI=1/C26H23N3O2/c1-17-5-4-6-20(11-17)16-31-24-10-8-19(14-25(24)30-3)13-21(15-27)26-28-22-9-7-18(2)12-23(22)29-26/h4-14H,16H2,1-3H3,(H,28,29) |
Nr CAS |
5312-97-0 |
EINECS |
226-169-2 |
Struktury molekularnej |
|
Gęstość |
1.23g/cm3 |
Temperatura topnienia |
80-82℃ |
Temperatura wrzenia |
638°C at 760 mmHg |
Współczynnik załamania |
1.672 |
Temperatura zapłonu |
339.6°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|