Nama produk |
2-Iodo-5-nitrotoluene |
Sinonim |
1-iodo-2-methyl-4-nitrobenzene; N-(1-methylethyl)phenazine-1-carboxamide |
MF |
C16H15N3O |
Berat Molekul |
265.3098 |
InChI |
InChI=1/C16H15N3O/c1-10(2)17-16(20)11-6-5-9-14-15(11)19-13-8-4-3-7-12(13)18-14/h3-10H,1-2H3,(H,17,20) |
CAS NO |
5326-38-5 |
EINECS |
226-204-1 |
Struktur Molekul |
|
Kepadatan |
1.217g/cm3 |
Titik didih |
531.5°C at 760 mmHg |
Indeks bias |
1.665 |
Titik nyala |
275.2°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|