Ονομασία του προϊόντος |
3-Hydroxy-2,4,6-triiodobenzoic acid |
Συνώνυμα |
2,4,6-Triiodo-3-hydroxybenzoic acid; 3-hydroxy-2,4,6-triiodobenzoate; HTBA |
MF |
C7H2I3O3 |
Μοριακό βάρος |
514.8029 |
InChI |
InChI=1/C7H3I3O3/c8-2-1-3(9)6(11)5(10)4(2)7(12)13/h1,11H,(H,12,13)/p-1 |
CAS ΟΧΙ |
53279-72-4 |
EINECS |
258-457-9 |
Μοριακή δομή |
|
Σημείο βρασμού |
389.2°C at 760 mmHg |
Σημείο ανάφλεξης |
189.2°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|