Produkt-Name |
3,4-dichlorobenzaldehyde oxime |
Synonyme |
3,4-Dichlorobenzaldoxime |
Molekulare Formel |
C7H5Cl2NO |
Molecular Weight |
190.0267 |
InChI |
InChI=1/C7H5Cl2NO/c8-6-2-1-5(4-10-11)3-7(6)9/h1-4,11H/b10-4+ |
CAS Registry Number |
5331-92-0 |
Molecular Structure |
|
Dichte |
1.38g/cm3 |
Schmelzpunkt |
118℃ |
Siedepunkt |
278.2°C at 760 mmHg |
Brechungsindex |
1.575 |
Flammpunkt |
122.1°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|