نام محصول |
4-Cyano-5-imidazolecarboxamide |
مترادف |
4-Cyano-1H-imidazole-5-carboxamide |
میدان مغناطیسی |
C5H4N4O |
وزن مولکولی |
136.1115 |
InChI |
InChI=1/C5H4N4O/c6-1-3-4(5(7)10)9-2-8-3/h2H,(H2,7,10)(H,8,9) |
شماره سیایاس |
5372-23-6 |
ساختار مولکولی |
|
تراکم |
1.51g/cm3 |
نقطه ذوب |
276℃ |
نقطه غلیان |
572.8°C at 760 mmHg |
ضریب شکست |
1.617 |
نقطه اشتعال |
300.2°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|