اسم المنتج |
2,5-dichlorophenyl isocyanate |
الاسم المستعار |
Isocyanic acid 2,5-dichlorophenyl ester; 2,5-Dichloroisocyanatobenzene; 1,4-dichloro-2-isocyanatobenzene |
الصيغة الجزيئية |
C7H3Cl2NO |
الوزن الجزيئي الغرامي |
188.0108 |
InChI |
InChI=1/C7H3Cl2NO/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
إستراتيجية المساعدة القطرية |
5392-82-5 |
المفوضية الأوروبية رقم |
226-396-7 |
بنية جزيئية |
|
كثافة |
1.37g/cm3 |
درجة الإنصهار |
29-31℃ |
نقطة الغليان |
241.6°C at 760 mmHg |
معامل الإنكسار |
1.575 |
نقطة الوميض |
92°C |
خطر المصطلحات |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|