Produkt-Name |
Ethyl trans-3-(1-pyrrolidino)acrylate |
Synonyme |
Ethyl trans-3-(1-pyrrolidino)propenoate; Ethyl3-(1-pyrrolidinyl)acrylate; ethyl (2E)-3-(pyrrolidin-1-yl)prop-2-enoate |
Molekulare Formel |
C9H15NO2 |
Molecular Weight |
169.2209 |
InChI |
InChI=1/C9H15NO2/c1-2-12-9(11)5-8-10-6-3-4-7-10/h5,8H,2-4,6-7H2,1H3/b8-5+ |
CAS Registry Number |
65651-80-1;53927-12-1 |
Molecular Structure |
|
Dichte |
1.112g/cm3 |
Siedepunkt |
245.9°C at 760 mmHg |
Brechungsindex |
1.554 |
Flammpunkt |
95.9°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|