نام محصول |
Ethyl 3-nitrocinnamate |
مترادف |
3-Nitrocinnamic acid ethyl ester; 2-{[2-chloro-5-(morpholin-4-ylsulfonyl)phenyl]amino}-2-oxoethyl pyrazine-2-carboxylate; ethyl (2E)-3-(3-nitrophenyl)prop-2-enoate |
میدان مغناطیسی |
C11H11NO4 |
وزن مولکولی |
221.2093 |
InChI |
InChI=1/C11H11NO4/c1-2-16-11(13)7-6-9-4-3-5-10(8-9)12(14)15/h3-8H,2H2,1H3/b7-6+ |
شماره سیایاس |
5396-71-4 |
تعداد کمیسیون اروپایی |
226-415-9 |
ساختار مولکولی |
|
تراکم |
1.237g/cm3 |
نقطه ذوب |
73-75℃ |
نقطه غلیان |
346.7°C at 760 mmHg |
ضریب شکست |
1.582 |
نقطه اشتعال |
154.5°C |
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|