نام محصول |
2-bromo-1-benzofuran |
مترادف |
2-bromobenzofuran |
میدان مغناطیسی |
C8H5BrO |
وزن مولکولی |
197.0287 |
InChI |
InChI=1/C8H5BrO/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5H |
شماره سیایاس |
54008-77-4 |
ساختار مولکولی |
|
تراکم |
1.608g/cm3 |
نقطه غلیان |
233.807°C at 760 mmHg |
ضریب شکست |
1.639 |
نقطه اشتعال |
95.203°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|