product Name |
Ethyl NN-Diethyloxamate |
Synonyms |
5411-58-5; Ethyl (diethylamino)(oxo)acetate; Ethyl diethyl oxamate; ETHYL N,N-DIETHYLOXAMATE; Ethyl NN-Diethyloxamate |
Molecular Formula |
C8H15NO3 |
Molecular Weight |
173.2096 |
InChI |
InChI=1/C8H15NO3/c1-4-9(5-2)7(10)8(11)12-6-3/h4-6H2,1-3H3 |
CAS Registry Number |
5411-58-5 |
Molecular Structure |
|
Density |
1.028g/cm3 |
Boiling point |
218.7°C at 760 mmHg |
Refractive index |
1.442 |
Flash point |
86°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|