उत्पाद का नाम |
Glutaranilic Acid |
समानार्थी |
N-Phenylglutaramic Acid; Pentanedioic acid mono(N-phenyl)amide; 5-oxo-5-(phenylamino)pentanoic acid; 5-oxo-5-(phenylamino)pentanoate |
आणविक फार्मूला |
C11H12NO3 |
आण्विक वजन |
206.2184 |
InChI |
InChI=1/C11H13NO3/c13-10(7-4-8-11(14)15)12-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,12,13)(H,14,15)/p-1 |
कैस रजिस्टी संख्या |
5414-99-3 |
आणविक संरचना |
|
उबलने का समय |
478.5°C at 760 mmHg |
फ्लैश प्वाइंट |
243.2°C |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|