상품명칭 |
Succinyl chloride |
별명 |
Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
분자식 |
C4H4Cl2O2 |
분자량 |
154.9794 |
InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
cas번호 |
543-20-4 |
EC번호 |
208-838-0 |
분자 구조 |
|
밀도 |
1.389g/cm3 |
녹는 점 |
16-17℃ |
비등점 |
193.4°C at 760 mmHg |
굴절 지수 |
1.456 |
인화점 |
76.7°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|