Naam product |
3-Cyano-4-methylpyridine |
Synoniemen |
3-Cyano-4-picoline; 4-Methylnicotinotrile; 4-Methylpyridine-3-carbonitrile; 4-Methyl-nicotinonitrile |
MF |
C7H6N2 |
Molecuulgewicht |
118.1359 |
InChI |
InChI=1/C7H6N2/c1-6-2-3-9-5-7(6)4-8/h2-3,5H,1H3 |
CAS-nummer |
5444-01-9 |
Moleculaire Structuur |
|
Dichtheid |
1.084g/cm3 |
Kookpunt |
231.723°C at 760 mmHg |
Brekingsindex |
1.531 |
Vlampunt |
92.223°C |
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|