Nazwa produktu: |
Methyl 2-bromooctanoate |
Synonimy |
2-Bromooctanoic acid methyl ester; 2-bromo-octanoicacimethylester; Methyl2-bromooctanoate,99+% |
MF |
C9H17BrO2 |
Masie cząsteczkowej |
237.1341 |
InChI |
InChI=1/C9H17BrO2/c1-3-4-5-6-7-8(10)9(11)12-2/h8H,3-7H2,1-2H3 |
Nr CAS |
5445-22-7 |
EINECS |
226-644-4 |
Struktury molekularnej |
|
Gęstość |
1.221g/cm3 |
Temperatura wrzenia |
227.7°C at 760 mmHg |
Współczynnik załamania |
1.46 |
Temperatura zapłonu |
101.9°C |
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|