product Name |
Ethyl 2-bromooctanoate |
Synonyms |
Ethyl 2-bromocaprylate; 2-Bromooctanoic acid ethyl ester; Octanoic acid, 2-bromoethyl ester; α-Bromo-octanoic acid ethyl ester; Ethyl 2-bromooctanoate, 98+%; Ethyl 2-caprylate; ALPHA-BROMO-OCTANOIC ACID ETHYL ESTER; ethyl (2S)-2-bromooctanoate; ethyl (2R)-2-bromooctanoate |
Molecular Formula |
C10H19BrO2 |
Molecular Weight |
251.1607 |
InChI |
InChI=1/C10H19BrO2/c1-3-5-6-7-8-9(11)10(12)13-4-2/h9H,3-8H2,1-2H3/t9-/m1/s1 |
CAS Registry Number |
5445-29-4 |
EINECS |
226-647-0 |
Molecular Structure |
|
Density |
1.192g/cm3 |
Boiling point |
243.1°C at 760 mmHg |
Refractive index |
1.461 |
Flash point |
112.1°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|