상품명칭 |
Ethyl 3-mercaptopropionate |
별명 |
3-Mercaptopropionic Acid Ethyl Ester; ethyl 3-sulfanylpropanoate |
분자식 |
C5H10O2S |
분자량 |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-2-7-5(6)3-4-8/h8H,2-4H2,1H3 |
cas번호 |
5466-06-8 |
EC번호 |
226-771-5 |
분자 구조 |
|
밀도 |
1.043g/cm3 |
비등점 |
194.3°C at 760 mmHg |
굴절 지수 |
1.454 |
인화점 |
72.8°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|