product Name |
Alpha-Cyano-3-hydroxycinnamic acid |
Synonyms |
alpha-Cyano-3-hydroxycinnamate; 2-Propenoic acid, 2-cyano-3-(3-hydroxyphenyl)-; alpha-Cyano-m-hydroxycinnamic acid; (2E)-2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid; (2Z)-3-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid; (2E)-2-cyano-3-(3-hydroxyphenyl)prop-2-enoate |
Molecular Formula |
C10H6NO3 |
Molecular Weight |
188.1601 |
InChI |
InChI=1/C10H7NO3/c11-6-8(10(13)14)4-7-2-1-3-9(12)5-7/h1-5,12H,(H,13,14)/p-1/b8-4+ |
CAS Registry Number |
54673-07-3 |
EINECS |
259-289-9 |
Molecular Structure |
|
Melting point |
230-233℃ |
Boiling point |
424.3°C at 760 mmHg |
Flash point |
210.4°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|