produktnavn |
Tetramethyltetraselenafulvalene |
Molekylær Formel |
C10H12Se4 |
Molekylvekt |
448.0423 |
InChI |
InChI=1/C10H12Se4/c1-5-6(2)12-9(11-5)10-13-7(3)8(4)14-10/h1-4H3 |
CAS-nummer |
55259-49-9 |
Molecular Structure |
|
Smeltepunkt |
265-270℃ |
Kokepunkt |
338.8°C at 760 mmHg |
Flammepunktet |
158.7°C |
Hazard symboler |
T:Toxic;
|
Risiko Koder |
R23/25:Toxic by inhalation and if swallowed.;
R33:Danger of cummulative effects.;
|
Sikkerhet Beskrivelse |
S20/21:When using do not eat, drink or smoke.;
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|