Nama produk |
Allylurea |
Sinonim |
2-Propenylurea; 1-Allylurea; 4-04-00-01070 (Beilstein Handbook Reference); AI3-23204; Allyl urea; Allylcarbamide; BRN 1745068; CCRIS 5958; Monoallylurea; N-2-Propenylurea; N-Allylurea; NSC 7607; Urea, 2-propenyl-; Urea, N-2-propen-1-yl-; Urea, allyl-; 1-prop-2-en-1-ylurea |
MF |
C4H8N2O |
Berat Molekul |
100.1191 |
InChI |
InChI=1/C4H8N2O/c1-2-3-6-4(5)7/h2H,1,3H2,(H3,5,6,7) |
CAS NO |
557-11-9 |
EINECS |
209-157-1 |
Struktur Molekul |
|
Kepadatan |
1.008g/cm3 |
Titik lebur |
80-85℃ |
Titik didih |
167.9°C at 760 mmHg |
Indeks bias |
1.465 |
Titik nyala |
55.3°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|