termék neve |
2,6-Dimethoxy-3-nitrobenzoic acid |
MF |
C9H9NO6 |
Molekulatömeg |
227.1709 |
InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
CAS-szám |
55776-17-5 |
EINECS |
259-814-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.403g/cm3 |
Forráspont |
420.7°C at 760 mmHg |
Törésmutató |
1.569 |
Gyulladáspont |
208.2°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|