product Name |
3-ethoxybenzamide |
Synonyms |
m-Ethoxybenzamide; Benzamide, 3-ethoxy- |
Molecular Formula |
C9H11NO2 |
Molecular Weight |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
CAS Registry Number |
55836-69-6 |
EINECS |
259-846-6 |
Molecular Structure |
|
Density |
1.111g/cm3 |
Melting point |
138-140℃ |
Boiling point |
293.4°C at 760 mmHg |
Refractive index |
1.538 |
Flash point |
145.8°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|