název výrobku |
4-Chloro-3-nitrobenzophenone |
Synonyma |
(4-Chloro-3-nitrophenyl)phenylmethanone |
Molekulární vzorec |
C13H8ClNO3 |
Molekulová hmotnost |
261.6605 |
InChI |
InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
Registrační číslo CAS |
56107-02-9 |
EINECS |
259-995-7 |
Molekulární struktura |
|
Hustota |
1.367g/cm3 |
Bod tání |
101-107℃ |
Bod varu |
386.5°C at 760 mmHg |
Index lomu |
1.623 |
Bod vzplanutí |
203.4°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|