Nome del prodotto |
DL-Phenylalanine methyl ester hydrochloride |
Sinonimi |
H-DL-Phe-OMe.HCl; methyl L-phenylalaninate hydrochloride (1:1); methyl phenylalaninate hydrochloride; H-DL-Phe-OMe・HCl |
Formula molecolare |
C10H14ClNO2 |
Peso Molecolare |
215.6767 |
InChI |
InChI=1/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H |
Numero CAS |
5619-07-8 |
EINECS |
227-049-2 |
Struttura molecolare |
|
Punto di ebollizione |
264.2°C at 760 mmHg |
Punto d'infiammabilità |
126°C |
Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|