Nama produk |
Diethyl acetylmalonate |
Sinonim |
Acetylmalonic acid diethyl ester; (2-ethylbutanoyl)propanedioate |
MF |
C9H12O5 |
Berat Molekul |
200.1897 |
InChI |
InChI=1/C9H14O5/c1-3-5(4-2)7(10)6(8(11)12)9(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/p-2 |
CAS NO |
570-08-1 |
Struktur Molekul |
|
Titik didih |
372.3°C at 760 mmHg |
Titik nyala |
193.1°C |
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|